C10H17N3 — CID 145125423
methanamine;1-N,2-N,4-trimethylcyclohexa-3,5-diene-1,2-diimine (PubChem CID 145125423) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is methanamine;1-N,2-N,4-trimethylcyclohexa-3,5-diene-1,2-diimine.
| Compound Name | methanamine;1-N,2-N,4-trimethylcyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 145125423 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | methanamine;1-N,2-N,4-trimethylcyclohexa-3,5-diene-1,2-diimine |
| SMILES | C/N=C1\C=CC(C)=C\C1=N/C.CN |
| InChI | InChI=1S/C9H12N2.CH5N/c1-7-4-5-8(10-2)9(6-7)11-3;1-2/h4-6H,1-3H3;2H2,1H3/b10-8+,11-9+; |
| InChIKey | SNTFURNYGKHNRN-HUISGVMCSA-N |
| XLogP | 1.22 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|