C22H40N2O4 — CID 14512544
bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-methylpropanedioate (PubChem CID 14512544) has the molecular formula C22H40N2O4 and a molecular weight of 396.57 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-methylpropanedioate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-methylpropanedioate |
|---|---|
| PubChem CID | 14512544 |
| Molecular Formula | C22H40N2O4 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-methylpropanedioate |
| SMILES | CC(C(=O)OC1CC(C)(C)NC(C)(C)C1)C(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C22H40N2O4/c1-14(17(25)27-15-10-19(2,3)23-20(4,5)11-15)18(26)28-16-12-21(6,7)24-22(8,9)13-16/h14-16,23-24H,10-13H2,1-9H3 |
| InChIKey | ZWNUSYHOKYAOIJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|