C25H46N2O6 — CID 14512548
bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2,2-diethylpropanedioate (PubChem CID 14512548) has the molecular formula C25H46N2O6 and a molecular weight of 470.65 g/mol. Its IUPAC name is bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2,2-diethylpropanedioate.
| Compound Name | bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 14512548 |
| Molecular Formula | C25H46N2O6 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2,2-diethylpropanedioate |
| SMILES | CCC(CC)(C(=O)OC1CC(C)(C)N(O)C(C)(C)C1)C(=O)OC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C25H46N2O6/c1-11-25(12-2,19(28)32-17-13-21(3,4)26(30)22(5,6)14-17)20(29)33-18-15-23(7,8)27(31)24(9,10)16-18/h17-18,30-31H,11-16H2,1-10H3 |
| InChIKey | TZXCUAGJURJYFE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|