C40H68N2O7 — CID 14512551
bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-butyl-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate (PubChem CID 14512551) has the molecular formula C40H68N2O7 and a molecular weight of 688.99 g/mol. Its IUPAC name is bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-butyl-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate.
| Compound Name | bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-butyl-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 14512551 |
| Molecular Formula | C40H68N2O7 |
| Molecular Weight | 688.99 g/mol |
| Exact Mass | 688.50 |
| IUPAC Name | bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-butyl-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate |
| SMILES | CCCCC(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)(C(=O)OC1CC(C)(C)N(O)C(C)(C)C1)C(=O)OC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C40H68N2O7/c1-16-17-18-40(32(44)48-27-22-36(8,9)41(46)37(10,11)23-27,33(45)49-28-24-38(12,13)42(47)39(14,15)25-28)21-26-19-29(34(2,3)4)31(43)30(20-26)35(5,6)7/h19-20,27-28,43,46-47H,16-18,21-25H2,1-15H3 |
| InChIKey | CGXQLYWEHYEIAP-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.99 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|