C44H78N4O12 — CID 14512552
tetrakis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate (PubChem CID 14512552) has the molecular formula C44H78N4O12 and a molecular weight of 855.12 g/mol. Its IUPAC name is tetrakis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate.
| Compound Name | tetrakis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 14512552 |
| Molecular Formula | C44H78N4O12 |
| Molecular Weight | 855.12 g/mol |
| Exact Mass | 854.56 |
| IUPAC Name | tetrakis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate |
| SMILES | CC1(C)CC(OC(=O)CC(C(=O)OC2CC(C)(C)N(O)C(C)(C)C2)C(CC(=O)OC2CC(C)(C)N(O)C(C)(C)C2)C(=O)OC2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1O |
| InChI | InChI=1S/C44H78N4O12/c1-37(2)19-27(20-38(3,4)45(37)53)57-33(49)17-31(35(51)59-29-23-41(9,10)47(55)42(11,12)24-29)32(36(52)60-30-25-43(13,14)48(56)44(15,16)26-30)18-34(50)58-28-21-39(5,6)46(54)40(7,8)22-28/h27-32,53-56H,17-26H2,1-16H3 |
| InChIKey | KTIZKSJSRBIEBR-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 199.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.12 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|