C18H18F2O — CID 145126370
(3E,7E)-9-cyclohexa-1,3-dien-1-yl-3,7-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-ol (PubChem CID 145126370) has the molecular formula C18H18F2O and a molecular weight of 288.34 g/mol. Its IUPAC name is (3E,7E)-9-cyclohexa-1,3-dien-1-yl-3,7-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-ol.
| Compound Name | (3E,7E)-9-cyclohexa-1,3-dien-1-yl-3,7-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-ol |
|---|---|
| PubChem CID | 145126370 |
| Molecular Formula | C18H18F2O |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (3E,7E)-9-cyclohexa-1,3-dien-1-yl-3,7-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-ol |
| SMILES | C=C(/C=C(\F)C(=C)O)C(=C)/C(F)=C\C(=C)C1=CC=CCC1 |
| InChI | InChI=1S/C18H18F2O/c1-12(10-18(20)15(4)21)14(3)17(19)11-13(2)16-8-6-5-7-9-16/h5-6,8,10-11,21H,1-4,7,9H2/b17-11+,18-10+ |
| InChIKey | PYVKJNFCQHCIRE-BOJOMDSJSA-N |
| XLogP | 5.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|