C12H13FO — CID 145126395
(3E)-5-cyclohexa-1,3-dien-1-yl-4-fluorohexa-1,3,5-trien-2-ol (PubChem CID 145126395) has the molecular formula C12H13FO and a molecular weight of 192.23 g/mol. Its IUPAC name is (3E)-5-cyclohexa-1,3-dien-1-yl-4-fluorohexa-1,3,5-trien-2-ol.
| Compound Name | (3E)-5-cyclohexa-1,3-dien-1-yl-4-fluorohexa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 145126395 |
| Molecular Formula | C12H13FO |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | (3E)-5-cyclohexa-1,3-dien-1-yl-4-fluorohexa-1,3,5-trien-2-ol |
| SMILES | C=C(O)/C=C(/F)C(=C)C1=CC=CCC1 |
| InChI | InChI=1S/C12H13FO/c1-9(14)8-12(13)10(2)11-6-4-3-5-7-11/h3-4,6,8,14H,1-2,5,7H2/b12-8+ |
| InChIKey | LUGFAKBFRRNPJE-XYOKQWHBSA-N |
| XLogP | 3.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|