C24H29FN6O3 — CID 145126604
N-[(Z)-5-amino-4-hydrazinylhex-4-enyl]-4-ethoxy-3-fluoro-2-(2-methoxy-4-pyridinyl)quinoline-7-carboxamide (PubChem CID 145126604) has the molecular formula C24H29FN6O3 and a molecular weight of 468.53 g/mol. Its IUPAC name is N-[(Z)-5-amino-4-hydrazinylhex-4-enyl]-4-ethoxy-3-fluoro-2-(2-methoxy-4-pyridinyl)quinoline-7-carboxamide.
| Compound Name | N-[(Z)-5-amino-4-hydrazinylhex-4-enyl]-4-ethoxy-3-fluoro-2-(2-methoxy-4-pyridinyl)quinoline-7-carboxamide |
|---|---|
| PubChem CID | 145126604 |
| Molecular Formula | C24H29FN6O3 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | N-[(Z)-5-amino-4-hydrazinylhex-4-enyl]-4-ethoxy-3-fluoro-2-(2-methoxy-4-pyridinyl)quinoline-7-carboxamide |
| SMILES | CCOc1c(F)c(-c2ccnc(OC)c2)nc2cc(C(=O)NCCC/C(NN)=C(\C)N)ccc12 |
| InChI | InChI=1S/C24H29FN6O3/c1-4-34-23-17-8-7-16(24(32)29-10-5-6-18(31-27)14(2)26)12-19(17)30-22(21(23)25)15-9-11-28-20(13-15)33-3/h7-9,11-13,31H,4-6,10,26-27H2,1-3H3,(H,29,32)/b18-14- |
| InChIKey | PBOMRVPBIJLHJM-JXAWBTAJSA-N |
| XLogP | 3.01 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|