C19H20FN5O2S — CID 145127394
4-[1-(2-cyanophenyl)sulfinyl-1-fluoroethyl]-N-pyridazin-4-ylpiperidine-1-carboxamide (PubChem CID 145127394) has the molecular formula C19H20FN5O2S and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-[1-(2-cyanophenyl)sulfinyl-1-fluoroethyl]-N-pyridazin-4-ylpiperidine-1-carboxamide.
| Compound Name | 4-[1-(2-cyanophenyl)sulfinyl-1-fluoroethyl]-N-pyridazin-4-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 145127394 |
| Molecular Formula | C19H20FN5O2S |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 4-[1-(2-cyanophenyl)sulfinyl-1-fluoroethyl]-N-pyridazin-4-ylpiperidine-1-carboxamide |
| SMILES | CC(F)(C1CCN(C(=O)Nc2ccnnc2)CC1)S(=O)c1ccccc1C#N |
| InChI | InChI=1S/C19H20FN5O2S/c1-19(20,28(27)17-5-3-2-4-14(17)12-21)15-7-10-25(11-8-15)18(26)24-16-6-9-22-23-13-16/h2-6,9,13,15H,7-8,10-11H2,1H3,(H,22,24,26) |
| InChIKey | HQZIAXSIDKQQBR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |