C6H3Cl2F7 — CID 14512773
5,6-dichloro-3,3,4,4,5,6,6-heptafluorohex-1-ene (PubChem CID 14512773) has the molecular formula C6H3Cl2F7 and a molecular weight of 278.98 g/mol. Its IUPAC name is 5,6-dichloro-3,3,4,4,5,6,6-heptafluorohex-1-ene.
| Compound Name | 5,6-dichloro-3,3,4,4,5,6,6-heptafluorohex-1-ene |
|---|---|
| PubChem CID | 14512773 |
| Molecular Formula | C6H3Cl2F7 |
| Molecular Weight | 278.98 g/mol |
| Exact Mass | 277.95 |
| IUPAC Name | 5,6-dichloro-3,3,4,4,5,6,6-heptafluorohex-1-ene |
| SMILES | C=CC(F)(F)C(F)(F)C(F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C6H3Cl2F7/c1-2-3(9,10)5(12,13)4(7,11)6(8,14)15/h2H,1H2 |
| InChIKey | FGEBIHPLEZRGLT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.98 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|