About ethane;(6R)-6-ethyl-4-methyl-5,6-dihydro-1H-benzimidazole
ethane;(6R)-6-ethyl-4-methyl-5,6-dihydro-1H-benzimidazole (PubChem CID 145127812) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is ethane;(6R)-6-ethyl-4-methyl-5,6-dihydro-1H-benzimidazole.
Molecular Properties
| Compound Name | ethane;(6R)-6-ethyl-4-methyl-5,6-dihydro-1H-benzimidazole |
| PubChem CID | 145127812 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | ethane;(6R)-6-ethyl-4-methyl-5,6-dihydro-1H-benzimidazole |
| SMILES | CC.CC[C@H]1C=c2[nH]cnc2=C(C)C1 |
| InChI | InChI=1S/C10H14N2.C2H6/c1-3-8-4-7(2)10-9(5-8)11-6-12-10;1-2/h5-6,8H,3-4H2,1-2H3,(H,11,12);1-2H3/t8-;/m1./s1 |
| InChIKey | ZGSSJLGMHCSRJZ-DDWIOCJRSA-N |
| XLogP | 1.82 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;(6R)-6-ethyl-4-methyl-5,6-dihydro-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(6R)-6-ethyl-4-methyl-5,6-dihydro-1H-benzimidazole?
The IUPAC name of ethane;(6R)-6-ethyl-4-methyl-5,6-dihydro-1H-benzimidazole (CID 145127812) is ethane;(6R)-6-ethyl-4-methyl-5,6-dihydro-1H-benzimidazole.
What is the SMILES notation for ethane;(6R)-6-ethyl-4-methyl-5,6-dihydro-1H-benzimidazole?
The canonical SMILES for ethane;(6R)-6-ethyl-4-methyl-5,6-dihydro-1H-benzimidazole is CC.CC[C@H]1C=c2[nH]cnc2=C(C)C1.
What is the InChIKey of ethane;(6R)-6-ethyl-4-methyl-5,6-dihydro-1H-benzimidazole?
The InChIKey is ZGSSJLGMHCSRJZ-DDWIOCJRSA-N. The full InChI is InChI=1S/C10H14N2.C2H6/c1-3-8-4-7(2)10-9(5-8)11-6-12-10;1-2/h5-6,8H,3-4H2,1-2H3,(H,11,12);1-2H3/t8-;/m1./s1.
What are the key properties of ethane;(6R)-6-ethyl-4-methyl-5,6-dihydro-1H-benzimidazole?
ethane;(6R)-6-ethyl-4-methyl-5,6-dihydro-1H-benzimidazole has a molecular weight of 192.31 g/mol, XLogP of 1.82, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(6R)-6-ethyl-4-methyl-5,6-dihydro-1H-benzimidazole is sourced from PubChem (CID 145127812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).