C22H24FN5O3 — CID 145128242
2-(4-fluoro-2-methylphenyl)-6-methyl-7,8-dihydro-5H-1,6-naphthyridine;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole (PubChem CID 145128242) has the molecular formula C22H24FN5O3 and a molecular weight of 425.46 g/mol. Its IUPAC name is 2-(4-fluoro-2-methylphenyl)-6-methyl-7,8-dihydro-5H-1,6-naphthyridine;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole.
| Compound Name | 2-(4-fluoro-2-methylphenyl)-6-methyl-7,8-dihydro-5H-1,6-naphthyridine;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 145128242 |
| Molecular Formula | C22H24FN5O3 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 2-(4-fluoro-2-methylphenyl)-6-methyl-7,8-dihydro-5H-1,6-naphthyridine;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
| SMILES | CC1Cn2cc([N+](=O)[O-])nc2O1.Cc1cc(F)ccc1-c1ccc2c(n1)CCN(C)C2 |
| InChI | InChI=1S/C16H17FN2.C6H7N3O3/c1-11-9-13(17)4-5-14(11)16-6-3-12-10-19(2)8-7-15(12)18-16;1-4-2-8-3-5(9(10)11)7-6(8)12-4/h3-6,9H,7-8,10H2,1-2H3;3-4H,2H2,1H3 |
| InChIKey | BIPLJIJIGCHXMF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 86.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|