C19H20FN5O3S — CID 145128284
2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole (PubChem CID 145128284) has the molecular formula C19H20FN5O3S and a molecular weight of 417.47 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole.
| Compound Name | 2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 145128284 |
| Molecular Formula | C19H20FN5O3S |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-(4-fluorophenyl)-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
| SMILES | CC1Cn2cc([N+](=O)[O-])nc2O1.CN1CCc2sc(-c3ccc(F)cc3)nc2C1 |
| InChI | InChI=1S/C13H13FN2S.C6H7N3O3/c1-16-7-6-12-11(8-16)15-13(17-12)9-2-4-10(14)5-3-9;1-4-2-8-3-5(9(10)11)7-6(8)12-4/h2-5H,6-8H2,1H3;3-4H,2H2,1H3 |
| InChIKey | RENFFJMEYZQEFA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 86.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|