C24H22N8OS — CID 145128545
2-[(2S)-1-[(5Z)-2-amino-5-ethylidene-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]azetidin-2-yl]-4-oxo-3-phenylpyrrolo[2,1-f][1,2,4]triazine-5-carbonitrile (PubChem CID 145128545) has the molecular formula C24H22N8OS and a molecular weight of 470.56 g/mol. Its IUPAC name is 2-[(2S)-1-[(5Z)-2-amino-5-ethylidene-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]azetidin-2-yl]-4-oxo-3-phenylpyrrolo[2,1-f][1,2,4]triazine-5-carbonitrile.
| Compound Name | 2-[(2S)-1-[(5Z)-2-amino-5-ethylidene-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]azetidin-2-yl]-4-oxo-3-phenylpyrrolo[2,1-f][1,2,4]triazine-5-carbonitrile |
|---|---|
| PubChem CID | 145128545 |
| Molecular Formula | C24H22N8OS |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 2-[(2S)-1-[(5Z)-2-amino-5-ethylidene-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]azetidin-2-yl]-4-oxo-3-phenylpyrrolo[2,1-f][1,2,4]triazine-5-carbonitrile |
| SMILES | C/C=S1/CCc2nc(N)nc(N3CC[C@H]3c3nn4ccc(C#N)c4c(=O)n3-c3ccccc3)c21 |
| InChI | InChI=1S/C24H22N8OS/c1-2-34-13-10-17-20(34)22(28-24(26)27-17)30-11-9-18(30)21-29-31-12-8-15(14-25)19(31)23(33)32(21)16-6-4-3-5-7-16/h2-8,12,18H,9-11,13H2,1H3,(H2,26,27,28)/t18-,34?/m0/s1 |
| InChIKey | ZXCWRHXPSQMZQD-HHVMLXBWSA-N |
| XLogP | 2.69 |
| TPSA | 118.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|