C17H23F3N2O4S — CID 145128852
4-[[(Z)-2-amino-2-(3,4,5-trifluorophenyl)ethenyl]amino]-2-(hydroxymethyl)-6-propylsulfanyloxane-3,5-diol (PubChem CID 145128852) has the molecular formula C17H23F3N2O4S and a molecular weight of 408.44 g/mol. Its IUPAC name is 4-[[(Z)-2-amino-2-(3,4,5-trifluorophenyl)ethenyl]amino]-2-(hydroxymethyl)-6-propylsulfanyloxane-3,5-diol.
| Compound Name | 4-[[(Z)-2-amino-2-(3,4,5-trifluorophenyl)ethenyl]amino]-2-(hydroxymethyl)-6-propylsulfanyloxane-3,5-diol |
|---|---|
| PubChem CID | 145128852 |
| Molecular Formula | C17H23F3N2O4S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 4-[[(Z)-2-amino-2-(3,4,5-trifluorophenyl)ethenyl]amino]-2-(hydroxymethyl)-6-propylsulfanyloxane-3,5-diol |
| SMILES | CCCSC1OC(CO)C(O)C(N/C=C(\N)c2cc(F)c(F)c(F)c2)C1O |
| InChI | InChI=1S/C17H23F3N2O4S/c1-2-3-27-17-16(25)14(15(24)12(7-23)26-17)22-6-11(21)8-4-9(18)13(20)10(19)5-8/h4-6,12,14-17,22-25H,2-3,7,21H2,1H3/b11-6- |
| InChIKey | VSYNBDLRYHBEBC-WDZFZDKYSA-N |
| XLogP | 0.90 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|