C19H28F2N2O4S — CID 145128888
4-[[(Z)-2-amino-2-(3,4-difluoro-5-methylphenyl)ethenyl]amino]-2-butylsulfanyl-6-(hydroxymethyl)oxane-3,5-diol (PubChem CID 145128888) has the molecular formula C19H28F2N2O4S and a molecular weight of 418.51 g/mol. Its IUPAC name is 4-[[(Z)-2-amino-2-(3,4-difluoro-5-methylphenyl)ethenyl]amino]-2-butylsulfanyl-6-(hydroxymethyl)oxane-3,5-diol.
| Compound Name | 4-[[(Z)-2-amino-2-(3,4-difluoro-5-methylphenyl)ethenyl]amino]-2-butylsulfanyl-6-(hydroxymethyl)oxane-3,5-diol |
|---|---|
| PubChem CID | 145128888 |
| Molecular Formula | C19H28F2N2O4S |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 4-[[(Z)-2-amino-2-(3,4-difluoro-5-methylphenyl)ethenyl]amino]-2-butylsulfanyl-6-(hydroxymethyl)oxane-3,5-diol |
| SMILES | CCCCSC1OC(CO)C(O)C(N/C=C(\N)c2cc(C)c(F)c(F)c2)C1O |
| InChI | InChI=1S/C19H28F2N2O4S/c1-3-4-5-28-19-18(26)16(17(25)14(9-24)27-19)23-8-13(22)11-6-10(2)15(21)12(20)7-11/h6-8,14,16-19,23-26H,3-5,9,22H2,1-2H3/b13-8- |
| InChIKey | VYSWZFIZIGYDTK-JYRVWZFOSA-N |
| XLogP | 1.46 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|