C23H26O7S — CID 145128973
[(3R,6R)-3,5-diacetyloxy-4-methyl-6-naphthalen-2-ylsulfanyloxan-2-yl]methyl acetate (PubChem CID 145128973) has the molecular formula C23H26O7S and a molecular weight of 446.52 g/mol. Its IUPAC name is [(3R,6R)-3,5-diacetyloxy-4-methyl-6-naphthalen-2-ylsulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-3,5-diacetyloxy-4-methyl-6-naphthalen-2-ylsulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 145128973 |
| Molecular Formula | C23H26O7S |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | [(3R,6R)-3,5-diacetyloxy-4-methyl-6-naphthalen-2-ylsulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](Sc2ccc3ccccc3c2)C(OC(C)=O)C(C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H26O7S/c1-13-21(28-15(3)25)20(12-27-14(2)24)30-23(22(13)29-16(4)26)31-19-10-9-17-7-5-6-8-18(17)11-19/h5-11,13,20-23H,12H2,1-4H3/t13?,20?,21-,22?,23-/m1/s1 |
| InChIKey | LDZLUXYPKIJKMT-MAZHHCAMSA-N |
| XLogP | 3.72 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|