C20H19ClF3N3O7 — CID 145128989
[(3R,6S)-3,5-diacetyloxy-6-chloro-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 145128989) has the molecular formula C20H19ClF3N3O7 and a molecular weight of 505.83 g/mol. Its IUPAC name is [(3R,6S)-3,5-diacetyloxy-6-chloro-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6S)-3,5-diacetyloxy-6-chloro-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 145128989 |
| Molecular Formula | C20H19ClF3N3O7 |
| Molecular Weight | 505.83 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | [(3R,6S)-3,5-diacetyloxy-6-chloro-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](Cl)C(OC(C)=O)C(n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H19ClF3N3O7/c1-8(28)31-7-15-18(32-9(2)29)17(19(20(21)34-15)33-10(3)30)27-6-14(25-26-27)11-4-12(22)16(24)13(23)5-11/h4-6,15,17-20H,7H2,1-3H3/t15?,17?,18-,19?,20+/m0/s1 |
| InChIKey | VUQVHNGSKSRGJT-OGVDZKCQSA-N |
| XLogP | 2.29 |
| TPSA | 118.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.83 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|