C20H21F3N2O4S — CID 145129096
4-[[(Z)-2-amino-2-(3,4,5-trifluorophenyl)ethenyl]amino]-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,5-diol (PubChem CID 145129096) has the molecular formula C20H21F3N2O4S and a molecular weight of 442.46 g/mol. Its IUPAC name is 4-[[(Z)-2-amino-2-(3,4,5-trifluorophenyl)ethenyl]amino]-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,5-diol.
| Compound Name | 4-[[(Z)-2-amino-2-(3,4,5-trifluorophenyl)ethenyl]amino]-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,5-diol |
|---|---|
| PubChem CID | 145129096 |
| Molecular Formula | C20H21F3N2O4S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 4-[[(Z)-2-amino-2-(3,4,5-trifluorophenyl)ethenyl]amino]-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,5-diol |
| SMILES | N/C(=C\NC1C(O)C(CO)OC(Sc2ccccc2)C1O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C20H21F3N2O4S/c21-12-6-10(7-13(22)16(12)23)14(24)8-25-17-18(27)15(9-26)29-20(19(17)28)30-11-4-2-1-3-5-11/h1-8,15,17-20,25-28H,9,24H2/b14-8- |
| InChIKey | FEBIBNPTAIKRPH-ZSOIEALJSA-N |
| XLogP | 1.55 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|