C26H34N2O3 — CID 145129404
1-cyclohexyl-5-(4-methylcyclohexa-1,5-dien-1-yl)-3-[2-(3-methylcyclohexa-1,5-dien-1-yl)ethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 145129404) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is 1-cyclohexyl-5-(4-methylcyclohexa-1,5-dien-1-yl)-3-[2-(3-methylcyclohexa-1,5-dien-1-yl)ethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-cyclohexyl-5-(4-methylcyclohexa-1,5-dien-1-yl)-3-[2-(3-methylcyclohexa-1,5-dien-1-yl)ethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 145129404 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 1-cyclohexyl-5-(4-methylcyclohexa-1,5-dien-1-yl)-3-[2-(3-methylcyclohexa-1,5-dien-1-yl)ethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CC1C=CC(C2C(=O)N(CCC3=CC(C)CC=C3)C(=O)N(C3CCCCC3)C2=O)=CC1 |
| InChI | InChI=1S/C26H34N2O3/c1-18-11-13-21(14-12-18)23-24(29)27(16-15-20-8-6-7-19(2)17-20)26(31)28(25(23)30)22-9-4-3-5-10-22/h6,8,11,13-14,17-19,22-23H,3-5,7,9-10,12,15-16H2,1-2H3 |
| InChIKey | YYNKPQAGGSTLPP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|