About 1-carbazol-9-yl-N,N-difluoromethanamine
1-carbazol-9-yl-N,N-difluoromethanamine (PubChem CID 145129490) has the molecular formula C13H10F2N2
and a molecular weight of 232.23 g/mol. Its IUPAC name is 1-carbazol-9-yl-N,N-difluoromethanamine.
Molecular Properties
| Compound Name | 1-carbazol-9-yl-N,N-difluoromethanamine |
| PubChem CID | 145129490 |
| Molecular Formula | C13H10F2N2 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-carbazol-9-yl-N,N-difluoromethanamine |
| SMILES | FN(F)Cn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C13H10F2N2/c14-17(15)9-16-12-7-3-1-5-10(12)11-6-2-4-8-13(11)16/h1-8H,9H2 |
| InChIKey | ZGSIHEBQGZTXSN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-carbazol-9-yl-N,N-difluoromethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbazol-9-yl-N,N-difluoromethanamine?
The IUPAC name of 1-carbazol-9-yl-N,N-difluoromethanamine (CID 145129490) is 1-carbazol-9-yl-N,N-difluoromethanamine.
What is the SMILES notation for 1-carbazol-9-yl-N,N-difluoromethanamine?
The canonical SMILES for 1-carbazol-9-yl-N,N-difluoromethanamine is FN(F)Cn1c2ccccc2c2ccccc21.
What is the InChIKey of 1-carbazol-9-yl-N,N-difluoromethanamine?
The InChIKey is ZGSIHEBQGZTXSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F2N2/c14-17(15)9-16-12-7-3-1-5-10(12)11-6-2-4-8-13(11)16/h1-8H,9H2.
What are the key properties of 1-carbazol-9-yl-N,N-difluoromethanamine?
1-carbazol-9-yl-N,N-difluoromethanamine has a molecular weight of 232.23 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbazol-9-yl-N,N-difluoromethanamine is sourced from PubChem (CID 145129490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).