C22H26N2O — CID 145129865
(NE)-N-[3-(cyclopentylmethyl)-4-imino-4-(4-phenylphenyl)butan-2-ylidene]hydroxylamine (PubChem CID 145129865) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is (NE)-N-[3-(cyclopentylmethyl)-4-imino-4-(4-phenylphenyl)butan-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[3-(cyclopentylmethyl)-4-imino-4-(4-phenylphenyl)butan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 145129865 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (NE)-N-[3-(cyclopentylmethyl)-4-imino-4-(4-phenylphenyl)butan-2-ylidene]hydroxylamine |
| SMILES | [H]/N=C(/c1ccc(-c2ccccc2)cc1)C(CC1CCCC1)/C(C)=N/O |
| InChI | InChI=1S/C22H26N2O/c1-16(24-25)21(15-17-7-5-6-8-17)22(23)20-13-11-19(12-14-20)18-9-3-2-4-10-18/h2-4,9-14,17,21,23,25H,5-8,15H2,1H3/b23-22-,24-16+ |
| InChIKey | PBLFJTIIYJTRKR-HGQKLARCSA-N |
| XLogP | 5.77 |
| TPSA | 56.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|