C15H22ClN5O2 — CID 145130943
4-chloro-5-ethanimidoyl-6-(methylamino)-N-(2-morpholin-4-ylethyl)pyridine-3-carboxamide (PubChem CID 145130943) has the molecular formula C15H22ClN5O2 and a molecular weight of 339.83 g/mol. Its IUPAC name is 4-chloro-5-ethanimidoyl-6-(methylamino)-N-(2-morpholin-4-ylethyl)pyridine-3-carboxamide.
| Compound Name | 4-chloro-5-ethanimidoyl-6-(methylamino)-N-(2-morpholin-4-ylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 145130943 |
| Molecular Formula | C15H22ClN5O2 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 4-chloro-5-ethanimidoyl-6-(methylamino)-N-(2-morpholin-4-ylethyl)pyridine-3-carboxamide |
| SMILES | [H]/N=C(\C)c1c(NC)ncc(C(=O)NCCN2CCOCC2)c1Cl |
| InChI | InChI=1S/C15H22ClN5O2/c1-10(17)12-13(16)11(9-20-14(12)18-2)15(22)19-3-4-21-5-7-23-8-6-21/h9,17H,3-8H2,1-2H3,(H,18,20)(H,19,22)/b17-10+ |
| InChIKey | XJUPPKZSAXSRLK-LICLKQGHSA-N |
| XLogP | 1.23 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|