C26H43N7O5 — CID 145131171
(2S)-N-[4-[3-amino-2-[[3-(1-formylpyrrolidin-2-yl)-3-methoxy-2-methylpropanoyl]amino]propyl]phenyl]-5-(carbamoylamino)-2-(methylamino)pentanamide (PubChem CID 145131171) has the molecular formula C26H43N7O5 and a molecular weight of 533.67 g/mol. Its IUPAC name is (2S)-N-[4-[3-amino-2-[[3-(1-formylpyrrolidin-2-yl)-3-methoxy-2-methylpropanoyl]amino]propyl]phenyl]-5-(carbamoylamino)-2-(methylamino)pentanamide.
| Compound Name | (2S)-N-[4-[3-amino-2-[[3-(1-formylpyrrolidin-2-yl)-3-methoxy-2-methylpropanoyl]amino]propyl]phenyl]-5-(carbamoylamino)-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 145131171 |
| Molecular Formula | C26H43N7O5 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.33 |
| IUPAC Name | (2S)-N-[4-[3-amino-2-[[3-(1-formylpyrrolidin-2-yl)-3-methoxy-2-methylpropanoyl]amino]propyl]phenyl]-5-(carbamoylamino)-2-(methylamino)pentanamide |
| SMILES | CN[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(CC(CN)NC(=O)C(C)C(OC)C2CCCN2C=O)cc1 |
| InChI | InChI=1S/C26H43N7O5/c1-17(23(38-3)22-7-5-13-33(22)16-34)24(35)32-20(15-27)14-18-8-10-19(11-9-18)31-25(36)21(29-2)6-4-12-30-26(28)37/h8-11,16-17,20-23,29H,4-7,12-15,27H2,1-3H3,(H,31,36)(H,32,35)(H3,28,30,37)/t17?,20?,21-,22?,23?/m0/s1 |
| InChIKey | CCRFDVBJELCUHM-UKAOBUODSA-N |
| XLogP | -0.08 |
| TPSA | 180.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|