C18H22O4 — CID 145131186
(6aR)-1-hydroxy-3,6,6,9-tetramethyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxylic acid (PubChem CID 145131186) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (6aR)-1-hydroxy-3,6,6,9-tetramethyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxylic acid.
| Compound Name | (6aR)-1-hydroxy-3,6,6,9-tetramethyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxylic acid |
|---|---|
| PubChem CID | 145131186 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (6aR)-1-hydroxy-3,6,6,9-tetramethyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxylic acid |
| SMILES | CC1=CC2c3c(cc(C)c(C(=O)O)c3O)OC(C)(C)[C@@H]2CC1 |
| InChI | InChI=1S/C18H22O4/c1-9-5-6-12-11(7-9)15-13(22-18(12,3)4)8-10(2)14(16(15)19)17(20)21/h7-8,11-12,19H,5-6H2,1-4H3,(H,20,21)/t11?,12-/m1/s1 |
| InChIKey | BWFHYGJGKLAXKO-PIJUOVFKSA-N |
| XLogP | 4.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|