C24H15F3O8 — CID 14513217
4-[1-(3,4-dicarboxyphenyl)-2,2,2-trifluoro-1-phenylethyl]phthalic acid (PubChem CID 14513217) has the molecular formula C24H15F3O8 and a molecular weight of 488.37 g/mol. Its IUPAC name is 4-[1-(3,4-dicarboxyphenyl)-2,2,2-trifluoro-1-phenylethyl]phthalic acid.
| Compound Name | 4-[1-(3,4-dicarboxyphenyl)-2,2,2-trifluoro-1-phenylethyl]phthalic acid |
|---|---|
| PubChem CID | 14513217 |
| Molecular Formula | C24H15F3O8 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 4-[1-(3,4-dicarboxyphenyl)-2,2,2-trifluoro-1-phenylethyl]phthalic acid |
| SMILES | O=C(O)c1ccc(C(c2ccccc2)(c2ccc(C(=O)O)c(C(=O)O)c2)C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C24H15F3O8/c25-24(26,27)23(12-4-2-1-3-5-12,13-6-8-15(19(28)29)17(10-13)21(32)33)14-7-9-16(20(30)31)18(11-14)22(34)35/h1-11H,(H,28,29)(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | PTWQVOITXCIGEB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|