C18H23BN2O3 — CID 145132292
3-ethenyl-2-ethyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 145132292) has the molecular formula C18H23BN2O3 and a molecular weight of 326.21 g/mol. Its IUPAC name is 3-ethenyl-2-ethyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-ethenyl-2-ethyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 145132292 |
| Molecular Formula | C18H23BN2O3 |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 3-ethenyl-2-ethyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | C=Cc1c(CC)nc2cc(B3OC(C)(C)C(C)(C)O3)ccn2c1=O |
| InChI | InChI=1S/C18H23BN2O3/c1-7-13-14(8-2)20-15-11-12(9-10-21(15)16(13)22)19-23-17(3,4)18(5,6)24-19/h7,9-11H,1,8H2,2-6H3 |
| InChIKey | QSHJOOSPGWXFDY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|