About CID 145132450
CID 145132450 (PubChem CID 145132450) has the molecular formula C63H64B3N6O6
and a molecular weight of 1033.68 g/mol.
Molecular Properties
| Compound Name | CID 145132450 |
| PubChem CID | 145132450 |
| Molecular Formula | C63H64B3N6O6 |
| Molecular Weight | 1033.68 g/mol |
| Exact Mass | 1033.52 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1ccc(-n2c(-c3cc(-c4nc5ccccc5n4-c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)cc(-c4nc5ccccc5n4-c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)c3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C63H64B3N6O6/c1-58(2,73)59(3,4)74-64-43-25-31-46(32-26-43)70-52-22-16-13-19-49(52)67-55(70)40-37-41(56-68-50-20-14-17-23-53(50)71(56)47-33-27-44(28-34-47)65-75-60(5,6)61(7,8)76-65)39-42(38-40)57-69-51-21-15-18-24-54(51)72(57)48-35-29-45(30-36-48)66-77-62(9,10)63(11,12)78-66/h13-39,73H,1-12H3 |
| InChIKey | MEYHUIBVRGZEHE-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 78 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1033.68 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 145132450 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145132450?
The IUPAC name of CID 145132450 (CID 145132450) is not available.
What is the SMILES notation for CID 145132450?
The canonical SMILES for CID 145132450 is CC(C)(O)C(C)(C)O[B]c1ccc(-n2c(-c3cc(-c4nc5ccccc5n4-c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)cc(-c4nc5ccccc5n4-c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)c3)nc3ccccc32)cc1.
What is the InChIKey of CID 145132450?
The InChIKey is MEYHUIBVRGZEHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C63H64B3N6O6/c1-58(2,73)59(3,4)74-64-43-25-31-46(32-26-43)70-52-22-16-13-19-49(52)67-55(70)40-37-41(56-68-50-20-14-17-23-53(50)71(56)47-33-27-44(28-34-47)65-75-60(5,6)61(7,8)76-65)39-42(38-40)57-69-51-21-15-18-24-54(51)72(57)48-35-29-45(30-36-48)66-77-62(9,10)63(11,12)78-66/h13-39,73H,1-12H3.
What are the key properties of CID 145132450?
CID 145132450 has a molecular weight of 1033.68 g/mol, XLogP of 11.11, 12 rotatable bonds, 1 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145132450 is sourced from PubChem (CID 145132450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).