C16H9BN2O — CID 145132459
CID 145132459 (PubChem CID 145132459) has the molecular formula C16H9BN2O and a molecular weight of 256.07 g/mol.
| Compound Name | CID 145132459 |
|---|---|
| PubChem CID | 145132459 |
| Molecular Formula | C16H9BN2O |
| Molecular Weight | 256.07 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(-c2ccc3oc4ccncc4c3c2)nc1 |
| InChI | InChI=1S/C16H9BN2O/c17-11-2-3-14(19-8-11)10-1-4-15-12(7-10)13-9-18-6-5-16(13)20-15/h1-9H |
| InChIKey | QIERGSFZXAVWOE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.07 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|