C18H30N2O — CID 145132932
1-[4-[[methyl(3-methylpentyl)amino]methyl]phenyl]pyrrolidin-2-one;molecular hydrogen (PubChem CID 145132932) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-[4-[[methyl(3-methylpentyl)amino]methyl]phenyl]pyrrolidin-2-one;molecular hydrogen.
| Compound Name | 1-[4-[[methyl(3-methylpentyl)amino]methyl]phenyl]pyrrolidin-2-one;molecular hydrogen |
|---|---|
| PubChem CID | 145132932 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 1-[4-[[methyl(3-methylpentyl)amino]methyl]phenyl]pyrrolidin-2-one;molecular hydrogen |
| SMILES | CCC(C)CCN(C)Cc1ccc(N2CCCC2=O)cc1.[H][H] |
| InChI | InChI=1S/C18H28N2O.H2/c1-4-15(2)11-13-19(3)14-16-7-9-17(10-8-16)20-12-5-6-18(20)21;/h7-10,15H,4-6,11-14H2,1-3H3;1H |
| InChIKey | GBKVRXZUXWDYHR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |