About 3-bromo-5-cyclohexa-1,5-dien-1-yl-2-methyl-7-phenylpyrazolo[1,5-a]pyrimidine;ethane
3-bromo-5-cyclohexa-1,5-dien-1-yl-2-methyl-7-phenylpyrazolo[1,5-a]pyrimidine;ethane (PubChem CID 145133519) has the molecular formula C21H22BrN3
and a molecular weight of 396.33 g/mol. Its IUPAC name is 3-bromo-5-cyclohexa-1,5-dien-1-yl-2-methyl-7-phenylpyrazolo[1,5-a]pyrimidine;ethane.
Molecular Properties
| Compound Name | 3-bromo-5-cyclohexa-1,5-dien-1-yl-2-methyl-7-phenylpyrazolo[1,5-a]pyrimidine;ethane |
| PubChem CID | 145133519 |
| Molecular Formula | C21H22BrN3 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 3-bromo-5-cyclohexa-1,5-dien-1-yl-2-methyl-7-phenylpyrazolo[1,5-a]pyrimidine;ethane |
| SMILES | CC.Cc1nn2c(-c3ccccc3)cc(C3=CCCC=C3)nc2c1Br |
| InChI | InChI=1S/C19H16BrN3.C2H6/c1-13-18(20)19-21-16(14-8-4-2-5-9-14)12-17(23(19)22-13)15-10-6-3-7-11-15;1-2/h3-4,6-12H,2,5H2,1H3;1-2H3 |
| InChIKey | CFTKJKDVCUWVPE-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-5-cyclohexa-1,5-dien-1-yl-2-methyl-7-phenylpyrazolo[1,5-a]pyrimidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-cyclohexa-1,5-dien-1-yl-2-methyl-7-phenylpyrazolo[1,5-a]pyrimidine;ethane?
The IUPAC name of 3-bromo-5-cyclohexa-1,5-dien-1-yl-2-methyl-7-phenylpyrazolo[1,5-a]pyrimidine;ethane (CID 145133519) is 3-bromo-5-cyclohexa-1,5-dien-1-yl-2-methyl-7-phenylpyrazolo[1,5-a]pyrimidine;ethane.
What is the SMILES notation for 3-bromo-5-cyclohexa-1,5-dien-1-yl-2-methyl-7-phenylpyrazolo[1,5-a]pyrimidine;ethane?
The canonical SMILES for 3-bromo-5-cyclohexa-1,5-dien-1-yl-2-methyl-7-phenylpyrazolo[1,5-a]pyrimidine;ethane is CC.Cc1nn2c(-c3ccccc3)cc(C3=CCCC=C3)nc2c1Br.
What is the InChIKey of 3-bromo-5-cyclohexa-1,5-dien-1-yl-2-methyl-7-phenylpyrazolo[1,5-a]pyrimidine;ethane?
The InChIKey is CFTKJKDVCUWVPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16BrN3.C2H6/c1-13-18(20)19-21-16(14-8-4-2-5-9-14)12-17(23(19)22-13)15-10-6-3-7-11-15;1-2/h3-4,6-12H,2,5H2,1H3;1-2H3.
What are the key properties of 3-bromo-5-cyclohexa-1,5-dien-1-yl-2-methyl-7-phenylpyrazolo[1,5-a]pyrimidine;ethane?
3-bromo-5-cyclohexa-1,5-dien-1-yl-2-methyl-7-phenylpyrazolo[1,5-a]pyrimidine;ethane has a molecular weight of 396.33 g/mol, XLogP of 6.23, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-cyclohexa-1,5-dien-1-yl-2-methyl-7-phenylpyrazolo[1,5-a]pyrimidine;ethane is sourced from PubChem (CID 145133519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).