C32H29BN2O2 — CID 145133607
9-(1-phenylindol-5-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole (PubChem CID 145133607) has the molecular formula C32H29BN2O2 and a molecular weight of 484.41 g/mol. Its IUPAC name is 9-(1-phenylindol-5-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole.
| Compound Name | 9-(1-phenylindol-5-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
|---|---|
| PubChem CID | 145133607 |
| Molecular Formula | C32H29BN2O2 |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 9-(1-phenylindol-5-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
| SMILES | CC1(C)OB(c2ccc3c(c2)c2ccccc2n3-c2ccc3c(ccn3-c3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C32H29BN2O2/c1-31(2)32(3,4)37-33(36-31)23-14-16-30-27(21-23)26-12-8-9-13-29(26)35(30)25-15-17-28-22(20-25)18-19-34(28)24-10-6-5-7-11-24/h5-21H,1-4H3 |
| InChIKey | SSQFMOWWALRRPO-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 28.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|