C51H45BrN2O — CID 145133691
3-[3-bromo-5-[9-(4-methoxyphenyl)carbazol-3-yl]phenyl]-9-phenylcarbazole;ethane;(2Z,4Z)-hexa-2,4-diene (PubChem CID 145133691) has the molecular formula C51H45BrN2O and a molecular weight of 781.84 g/mol. Its IUPAC name is 3-[3-bromo-5-[9-(4-methoxyphenyl)carbazol-3-yl]phenyl]-9-phenylcarbazole;ethane;(2Z,4Z)-hexa-2,4-diene.
| Compound Name | 3-[3-bromo-5-[9-(4-methoxyphenyl)carbazol-3-yl]phenyl]-9-phenylcarbazole;ethane;(2Z,4Z)-hexa-2,4-diene |
|---|---|
| PubChem CID | 145133691 |
| Molecular Formula | C51H45BrN2O |
| Molecular Weight | 781.84 g/mol |
| Exact Mass | 780.27 |
| IUPAC Name | 3-[3-bromo-5-[9-(4-methoxyphenyl)carbazol-3-yl]phenyl]-9-phenylcarbazole;ethane;(2Z,4Z)-hexa-2,4-diene |
| SMILES | C/C=C\C=C/C.CC.COc1ccc(-n2c3ccccc3c3cc(-c4cc(Br)cc(-c5ccc6c(c5)c5ccccc5n6-c5ccccc5)c4)ccc32)cc1 |
| InChI | InChI=1S/C43H29BrN2O.C6H10.C2H6/c1-47-35-19-17-34(18-20-35)46-41-14-8-6-12-37(41)39-27-29(16-22-43(39)46)31-23-30(24-32(44)25-31)28-15-21-42-38(26-28)36-11-5-7-13-40(36)45(42)33-9-3-2-4-10-33;1-3-5-6-4-2;1-2/h2-27H,1H3;3-6H,1-2H3;1-2H3/b;5-3-,6-4-; |
| InChIKey | JCIVEXBYBXXRFJ-DOUHFRIOSA-N |
| XLogP | 15.15 |
| TPSA | 19.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.84 |
| LogP ≤ 5 | 15.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|