C13H23NO — CID 145134002
6,7-bis(ethenyl)-3,5-dimethyl-2,3,4,5-tetrahydro-1,4-oxazepine;ethane (PubChem CID 145134002) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 6,7-bis(ethenyl)-3,5-dimethyl-2,3,4,5-tetrahydro-1,4-oxazepine;ethane.
| Compound Name | 6,7-bis(ethenyl)-3,5-dimethyl-2,3,4,5-tetrahydro-1,4-oxazepine;ethane |
|---|---|
| PubChem CID | 145134002 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 6,7-bis(ethenyl)-3,5-dimethyl-2,3,4,5-tetrahydro-1,4-oxazepine;ethane |
| SMILES | C=CC1=C(C=C)C(C)NC(C)CO1.CC |
| InChI | InChI=1S/C11H17NO.C2H6/c1-5-10-9(4)12-8(3)7-13-11(10)6-2;1-2/h5-6,8-9,12H,1-2,7H2,3-4H3;1-2H3 |
| InChIKey | IVGGGJNTSXGXAM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |