C18H26F2N2O2 — CID 145134217
tert-butyl 3,3-difluoro-4-(1-phenylethylamino)piperidine-1-carboxylate (PubChem CID 145134217) has the molecular formula C18H26F2N2O2 and a molecular weight of 340.41 g/mol. Its IUPAC name is tert-butyl 3,3-difluoro-4-(1-phenylethylamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3,3-difluoro-4-(1-phenylethylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 145134217 |
| Molecular Formula | C18H26F2N2O2 |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | tert-butyl 3,3-difluoro-4-(1-phenylethylamino)piperidine-1-carboxylate |
| SMILES | CC(NC1CCN(C(=O)OC(C)(C)C)CC1(F)F)c1ccccc1 |
| InChI | InChI=1S/C18H26F2N2O2/c1-13(14-8-6-5-7-9-14)21-15-10-11-22(12-18(15,19)20)16(23)24-17(2,3)4/h5-9,13,15,21H,10-12H2,1-4H3 |
| InChIKey | XQBADGQQWYXMFZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |