C18H32N2O2 — CID 145134277
(3E,5E)-5-[[5-(methylamino)pentylamino]oxymethyl]undeca-1,3,5,10-tetraen-3-ol (PubChem CID 145134277) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is (3E,5E)-5-[[5-(methylamino)pentylamino]oxymethyl]undeca-1,3,5,10-tetraen-3-ol.
| Compound Name | (3E,5E)-5-[[5-(methylamino)pentylamino]oxymethyl]undeca-1,3,5,10-tetraen-3-ol |
|---|---|
| PubChem CID | 145134277 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | (3E,5E)-5-[[5-(methylamino)pentylamino]oxymethyl]undeca-1,3,5,10-tetraen-3-ol |
| SMILES | C=CCCC/C=C(\C=C(\O)C=C)CONCCCCCNC |
| InChI | InChI=1S/C18H32N2O2/c1-4-6-7-9-12-17(15-18(21)5-2)16-22-20-14-11-8-10-13-19-3/h4-5,12,15,19-21H,1-2,6-11,13-14,16H2,3H3/b17-12+,18-15+ |
| InChIKey | MJXCLJNYOLBQSC-NLKSIUOISA-N |
| XLogP | 3.81 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|