About 4-(3,4-dimethylpyrazol-1-yl)piperidine-1-carbaldehyde;ethane;N-methylcyclopropanamine
4-(3,4-dimethylpyrazol-1-yl)piperidine-1-carbaldehyde;ethane;N-methylcyclopropanamine (PubChem CID 145134343) has the molecular formula C19H38N4O
and a molecular weight of 338.54 g/mol. Its IUPAC name is 4-(3,4-dimethylpyrazol-1-yl)piperidine-1-carbaldehyde;ethane;N-methylcyclopropanamine.
Molecular Properties
| Compound Name | 4-(3,4-dimethylpyrazol-1-yl)piperidine-1-carbaldehyde;ethane;N-methylcyclopropanamine |
| PubChem CID | 145134343 |
| Molecular Formula | C19H38N4O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | 4-(3,4-dimethylpyrazol-1-yl)piperidine-1-carbaldehyde;ethane;N-methylcyclopropanamine |
| SMILES | CC.CC.CNC1CC1.Cc1cn(C2CCN(C=O)CC2)nc1C |
| InChI | InChI=1S/C11H17N3O.C4H9N.2C2H6/c1-9-7-14(12-10(9)2)11-3-5-13(8-15)6-4-11;1-5-4-2-3-4;2*1-2/h7-8,11H,3-6H2,1-2H3;4-5H,2-3H2,1H3;2*1-2H3 |
| InChIKey | CWGCHABWWOUAIN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,4-dimethylpyrazol-1-yl)piperidine-1-carbaldehyde;ethane;N-methylcyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethylpyrazol-1-yl)piperidine-1-carbaldehyde;ethane;N-methylcyclopropanamine?
The IUPAC name of 4-(3,4-dimethylpyrazol-1-yl)piperidine-1-carbaldehyde;ethane;N-methylcyclopropanamine (CID 145134343) is 4-(3,4-dimethylpyrazol-1-yl)piperidine-1-carbaldehyde;ethane;N-methylcyclopropanamine.
What is the SMILES notation for 4-(3,4-dimethylpyrazol-1-yl)piperidine-1-carbaldehyde;ethane;N-methylcyclopropanamine?
The canonical SMILES for 4-(3,4-dimethylpyrazol-1-yl)piperidine-1-carbaldehyde;ethane;N-methylcyclopropanamine is CC.CC.CNC1CC1.Cc1cn(C2CCN(C=O)CC2)nc1C.
What is the InChIKey of 4-(3,4-dimethylpyrazol-1-yl)piperidine-1-carbaldehyde;ethane;N-methylcyclopropanamine?
The InChIKey is CWGCHABWWOUAIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O.C4H9N.2C2H6/c1-9-7-14(12-10(9)2)11-3-5-13(8-15)6-4-11;1-5-4-2-3-4;2*1-2/h7-8,11H,3-6H2,1-2H3;4-5H,2-3H2,1H3;2*1-2H3.
What are the key properties of 4-(3,4-dimethylpyrazol-1-yl)piperidine-1-carbaldehyde;ethane;N-methylcyclopropanamine?
4-(3,4-dimethylpyrazol-1-yl)piperidine-1-carbaldehyde;ethane;N-methylcyclopropanamine has a molecular weight of 338.54 g/mol, XLogP of 3.71, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethylpyrazol-1-yl)piperidine-1-carbaldehyde;ethane;N-methylcyclopropanamine is sourced from PubChem (CID 145134343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).