C24H28N6O3S — CID 145134363
16-(oxan-4-yl)-9-thia-5,12,15,16,19,25-hexazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(25),2(26),3,14,17,21,23-heptaene-13,20-dione (PubChem CID 145134363) has the molecular formula C24H28N6O3S and a molecular weight of 480.59 g/mol. Its IUPAC name is 16-(oxan-4-yl)-9-thia-5,12,15,16,19,25-hexazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(25),2(26),3,14,17,21,23-heptaene-13,20-dione.
| Compound Name | 16-(oxan-4-yl)-9-thia-5,12,15,16,19,25-hexazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(25),2(26),3,14,17,21,23-heptaene-13,20-dione |
|---|---|
| PubChem CID | 145134363 |
| Molecular Formula | C24H28N6O3S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 16-(oxan-4-yl)-9-thia-5,12,15,16,19,25-hexazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(25),2(26),3,14,17,21,23-heptaene-13,20-dione |
| SMILES | O=C1Nc2cn(C3CCOCC3)nc2C(=O)NCCSCCCn2ccc(c2)-c2cccc1n2 |
| InChI | InChI=1S/C24H28N6O3S/c31-23-20-4-1-3-19(26-20)17-5-10-29(15-17)9-2-13-34-14-8-25-24(32)22-21(27-23)16-30(28-22)18-6-11-33-12-7-18/h1,3-5,10,15-16,18H,2,6-9,11-14H2,(H,25,32)(H,27,31) |
| InChIKey | OTRNCYCBAWIJID-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |