C24H23NO2 — CID 145135798
4-[3-(1-hydroxyethenyl)-9,10-dimethyl-2-methylidene-6,7-dihydrobenzo[a]quinolizin-6-yl]phenol (PubChem CID 145135798) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is 4-[3-(1-hydroxyethenyl)-9,10-dimethyl-2-methylidene-6,7-dihydrobenzo[a]quinolizin-6-yl]phenol.
| Compound Name | 4-[3-(1-hydroxyethenyl)-9,10-dimethyl-2-methylidene-6,7-dihydrobenzo[a]quinolizin-6-yl]phenol |
|---|---|
| PubChem CID | 145135798 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-[3-(1-hydroxyethenyl)-9,10-dimethyl-2-methylidene-6,7-dihydrobenzo[a]quinolizin-6-yl]phenol |
| SMILES | C=C(O)C1=CN2C(=CC1=C)c1cc(C)c(C)cc1CC2c1ccc(O)cc1 |
| InChI | InChI=1S/C24H23NO2/c1-14-9-19-12-23(18-5-7-20(27)8-6-18)25-13-22(17(4)26)16(3)11-24(25)21(19)10-15(14)2/h5-11,13,23,26-27H,3-4,12H2,1-2H3 |
| InChIKey | UWHVPJNXFYSYSF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|