C30H43NO — CID 145135902
ethane;1-[9-ethyl-6-[(2E,4Z)-hexa-2,4-dien-2-yl]-10-methyl-2-methylidene-6,7-dihydrobenzo[a]quinolizin-3-yl]ethenol;propane (PubChem CID 145135902) has the molecular formula C30H43NO and a molecular weight of 433.68 g/mol. Its IUPAC name is ethane;1-[9-ethyl-6-[(2E,4Z)-hexa-2,4-dien-2-yl]-10-methyl-2-methylidene-6,7-dihydrobenzo[a]quinolizin-3-yl]ethenol;propane.
| Compound Name | ethane;1-[9-ethyl-6-[(2E,4Z)-hexa-2,4-dien-2-yl]-10-methyl-2-methylidene-6,7-dihydrobenzo[a]quinolizin-3-yl]ethenol;propane |
|---|---|
| PubChem CID | 145135902 |
| Molecular Formula | C30H43NO |
| Molecular Weight | 433.68 g/mol |
| Exact Mass | 433.33 |
| IUPAC Name | ethane;1-[9-ethyl-6-[(2E,4Z)-hexa-2,4-dien-2-yl]-10-methyl-2-methylidene-6,7-dihydrobenzo[a]quinolizin-3-yl]ethenol;propane |
| SMILES | C=C(O)C1=CN2C(=CC1=C)c1cc(C)c(CC)cc1CC2/C(C)=C/C=C\C.CC.CCC |
| InChI | InChI=1S/C25H29NO.C3H8.C2H6/c1-7-9-10-16(3)24-14-21-13-20(8-2)17(4)11-22(21)25-12-18(5)23(19(6)27)15-26(24)25;1-3-2;1-2/h7,9-13,15,24,27H,5-6,8,14H2,1-4H3;3H2,1-2H3;1-2H3/b9-7-,16-10+;; |
| InChIKey | UGRYHXPGRYCFBD-BMPKYXDUSA-N |
| XLogP | 8.62 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.68 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|