C32H32N4O5 — CID 145136180
[4-amino-1-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]piperidin-3-yl] 4-nitrobenzoate;ethane (PubChem CID 145136180) has the molecular formula C32H32N4O5 and a molecular weight of 552.63 g/mol. Its IUPAC name is [4-amino-1-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]piperidin-3-yl] 4-nitrobenzoate;ethane.
| Compound Name | [4-amino-1-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]piperidin-3-yl] 4-nitrobenzoate;ethane |
|---|---|
| PubChem CID | 145136180 |
| Molecular Formula | C32H32N4O5 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | [4-amino-1-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]piperidin-3-yl] 4-nitrobenzoate;ethane |
| SMILES | CC.NC1CCN(Cc2ccc3cncc(-c4cc5ccccc5o4)c3c2)CC1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H26N4O5.C2H6/c31-26-11-12-33(18-29(26)39-30(35)20-7-9-23(10-8-20)34(36)37)17-19-5-6-22-15-32-16-25(24(22)13-19)28-14-21-3-1-2-4-27(21)38-28;1-2/h1-10,13-16,26,29H,11-12,17-18,31H2;1-2H3 |
| InChIKey | MCOKPKLPGGZHEN-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 124.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|