About 4,6-dimethyl-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidine;ethane
4,6-dimethyl-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidine;ethane (PubChem CID 145136419) has the molecular formula C15H21F3N4
and a molecular weight of 314.36 g/mol. Its IUPAC name is 4,6-dimethyl-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidine;ethane.
Molecular Properties
| Compound Name | 4,6-dimethyl-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidine;ethane |
| PubChem CID | 145136419 |
| Molecular Formula | C15H21F3N4 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 4,6-dimethyl-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidine;ethane |
| SMILES | CC.CC.Cc1cc(C)nc(-c2cnc(C(F)(F)F)nc2)n1 |
| InChI | InChI=1S/C11H9F3N4.2C2H6/c1-6-3-7(2)18-9(17-6)8-4-15-10(16-5-8)11(12,13)14;2*1-2/h3-5H,1-2H3;2*1-2H3 |
| InChIKey | BWDHQIQVRKCJRZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-dimethyl-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidine;ethane?
The IUPAC name of 4,6-dimethyl-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidine;ethane (CID 145136419) is 4,6-dimethyl-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidine;ethane.
What is the SMILES notation for 4,6-dimethyl-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidine;ethane?
The canonical SMILES for 4,6-dimethyl-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidine;ethane is CC.CC.Cc1cc(C)nc(-c2cnc(C(F)(F)F)nc2)n1.
What is the InChIKey of 4,6-dimethyl-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidine;ethane?
The InChIKey is BWDHQIQVRKCJRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3N4.2C2H6/c1-6-3-7(2)18-9(17-6)8-4-15-10(16-5-8)11(12,13)14;2*1-2/h3-5H,1-2H3;2*1-2H3.
What are the key properties of 4,6-dimethyl-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidine;ethane?
4,6-dimethyl-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidine;ethane has a molecular weight of 314.36 g/mol, XLogP of 4.62, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidine;ethane is sourced from PubChem (CID 145136419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).