About 2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide
2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide (PubChem CID 145136555) has the molecular formula C7H9F3N2
and a molecular weight of 178.16 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide.
Molecular Properties
| Compound Name | 2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide |
| PubChem CID | 145136555 |
| Molecular Formula | C7H9F3N2 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide |
| SMILES | C=N/C(=N\C=C(C)C)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N2/c1-5(2)4-12-6(11-3)7(8,9)10/h4H,3H2,1-2H3/b12-6- |
| InChIKey | PRLFWCOQKLHNOZ-SDQBBNPISA-N |
| XLogP | 2.57 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide?
The IUPAC name of 2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide (CID 145136555) is 2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide.
What is the SMILES notation for 2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide?
The canonical SMILES for 2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide is C=N/C(=N\C=C(C)C)C(F)(F)F.
What is the InChIKey of 2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide?
The InChIKey is PRLFWCOQKLHNOZ-SDQBBNPISA-N. The full InChI is InChI=1S/C7H9F3N2/c1-5(2)4-12-6(11-3)7(8,9)10/h4H,3H2,1-2H3/b12-6-.
What are the key properties of 2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide?
2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide has a molecular weight of 178.16 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide is sourced from PubChem (CID 145136555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).