About 5-(1,1-difluoroethyl)-2-methylpyridine;ethane
5-(1,1-difluoroethyl)-2-methylpyridine;ethane (PubChem CID 145136619) has the molecular formula C12H21F2N
and a molecular weight of 217.30 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-2-methylpyridine;ethane.
Molecular Properties
| Compound Name | 5-(1,1-difluoroethyl)-2-methylpyridine;ethane |
| PubChem CID | 145136619 |
| Molecular Formula | C12H21F2N |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 5-(1,1-difluoroethyl)-2-methylpyridine;ethane |
| SMILES | CC.CC.Cc1ccc(C(C)(F)F)cn1 |
| InChI | InChI=1S/C8H9F2N.2C2H6/c1-6-3-4-7(5-11-6)8(2,9)10;2*1-2/h3-5H,1-2H3;2*1-2H3 |
| InChIKey | ICVOFXIOBGKGST-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(1,1-difluoroethyl)-2-methylpyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,1-difluoroethyl)-2-methylpyridine;ethane?
The IUPAC name of 5-(1,1-difluoroethyl)-2-methylpyridine;ethane (CID 145136619) is 5-(1,1-difluoroethyl)-2-methylpyridine;ethane.
What is the SMILES notation for 5-(1,1-difluoroethyl)-2-methylpyridine;ethane?
The canonical SMILES for 5-(1,1-difluoroethyl)-2-methylpyridine;ethane is CC.CC.Cc1ccc(C(C)(F)F)cn1.
What is the InChIKey of 5-(1,1-difluoroethyl)-2-methylpyridine;ethane?
The InChIKey is ICVOFXIOBGKGST-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2N.2C2H6/c1-6-3-4-7(5-11-6)8(2,9)10;2*1-2/h3-5H,1-2H3;2*1-2H3.
What are the key properties of 5-(1,1-difluoroethyl)-2-methylpyridine;ethane?
5-(1,1-difluoroethyl)-2-methylpyridine;ethane has a molecular weight of 217.30 g/mol, XLogP of 4.55, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,1-difluoroethyl)-2-methylpyridine;ethane is sourced from PubChem (CID 145136619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).