C20H18F9N5O — CID 145136832
1-[4-[amino-[(Z)-2-amino-3,3,4,4,5,5,6,6,6-nonafluorohex-1-enyl]amino]phenyl]-3-(2-methylphenyl)urea (PubChem CID 145136832) has the molecular formula C20H18F9N5O and a molecular weight of 515.38 g/mol. Its IUPAC name is 1-[4-[amino-[(Z)-2-amino-3,3,4,4,5,5,6,6,6-nonafluorohex-1-enyl]amino]phenyl]-3-(2-methylphenyl)urea.
| Compound Name | 1-[4-[amino-[(Z)-2-amino-3,3,4,4,5,5,6,6,6-nonafluorohex-1-enyl]amino]phenyl]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 145136832 |
| Molecular Formula | C20H18F9N5O |
| Molecular Weight | 515.38 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 1-[4-[amino-[(Z)-2-amino-3,3,4,4,5,5,6,6,6-nonafluorohex-1-enyl]amino]phenyl]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)Nc1ccc(N(N)/C=C(\N)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18F9N5O/c1-11-4-2-3-5-14(11)33-16(35)32-12-6-8-13(9-7-12)34(31)10-15(30)17(21,22)18(23,24)19(25,26)20(27,28)29/h2-10H,30-31H2,1H3,(H2,32,33,35)/b15-10- |
| InChIKey | GIHLUNUGRDQQNI-GDNBJRDFSA-N |
| XLogP | 5.59 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.38 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|