C22H26OS — CID 145137065
4-cyclohepta-1,3,6-trien-1-yl-5-methylidene-3-[(2E,4Z)-6-methylsulfanylhexa-2,4-dien-3-yl]-2H-furan;prop-1-yne (PubChem CID 145137065) has the molecular formula C22H26OS and a molecular weight of 338.52 g/mol. Its IUPAC name is 4-cyclohepta-1,3,6-trien-1-yl-5-methylidene-3-[(2E,4Z)-6-methylsulfanylhexa-2,4-dien-3-yl]-2H-furan;prop-1-yne.
| Compound Name | 4-cyclohepta-1,3,6-trien-1-yl-5-methylidene-3-[(2E,4Z)-6-methylsulfanylhexa-2,4-dien-3-yl]-2H-furan;prop-1-yne |
|---|---|
| PubChem CID | 145137065 |
| Molecular Formula | C22H26OS |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 4-cyclohepta-1,3,6-trien-1-yl-5-methylidene-3-[(2E,4Z)-6-methylsulfanylhexa-2,4-dien-3-yl]-2H-furan;prop-1-yne |
| SMILES | C#CC.C=C1OCC(C(/C=C\CSC)=C/C)=C1C1=CC=CCC=C1 |
| InChI | InChI=1S/C19H22OS.C3H4/c1-4-16(12-9-13-21-3)18-14-20-15(2)19(18)17-10-7-5-6-8-11-17;1-3-2/h4-5,7-12H,2,6,13-14H2,1,3H3;1H,2H3/b12-9-,16-4+; |
| InChIKey | YURDULXVFWTHMU-GCNQPFQISA-N |
| XLogP | 5.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|