About 4-butyl-5-[4-hydroxy-2-(trifluoromethyl)phenyl]thieno[3,2-b]pyrrole-2-carboxylic acid;ethane
4-butyl-5-[4-hydroxy-2-(trifluoromethyl)phenyl]thieno[3,2-b]pyrrole-2-carboxylic acid;ethane (PubChem CID 145137115) has the molecular formula C20H22F3NO3S
and a molecular weight of 413.46 g/mol. Its IUPAC name is 4-butyl-5-[4-hydroxy-2-(trifluoromethyl)phenyl]thieno[3,2-b]pyrrole-2-carboxylic acid;ethane.
Molecular Properties
| Compound Name | 4-butyl-5-[4-hydroxy-2-(trifluoromethyl)phenyl]thieno[3,2-b]pyrrole-2-carboxylic acid;ethane |
| PubChem CID | 145137115 |
| Molecular Formula | C20H22F3NO3S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 4-butyl-5-[4-hydroxy-2-(trifluoromethyl)phenyl]thieno[3,2-b]pyrrole-2-carboxylic acid;ethane |
| SMILES | CC.CCCCn1c(-c2ccc(O)cc2C(F)(F)F)cc2sc(C(=O)O)cc21 |
| InChI | InChI=1S/C18H16F3NO3S.C2H6/c1-2-3-6-22-13(8-15-14(22)9-16(26-15)17(24)25)11-5-4-10(23)7-12(11)18(19,20)21;1-2/h4-5,7-9,23H,2-3,6H2,1H3,(H,24,25);1-2H3 |
| InChIKey | MJGXKPPPSABOCM-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-butyl-5-[4-hydroxy-2-(trifluoromethyl)phenyl]thieno[3,2-b]pyrrole-2-carboxylic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-5-[4-hydroxy-2-(trifluoromethyl)phenyl]thieno[3,2-b]pyrrole-2-carboxylic acid;ethane?
The IUPAC name of 4-butyl-5-[4-hydroxy-2-(trifluoromethyl)phenyl]thieno[3,2-b]pyrrole-2-carboxylic acid;ethane (CID 145137115) is 4-butyl-5-[4-hydroxy-2-(trifluoromethyl)phenyl]thieno[3,2-b]pyrrole-2-carboxylic acid;ethane.
What is the SMILES notation for 4-butyl-5-[4-hydroxy-2-(trifluoromethyl)phenyl]thieno[3,2-b]pyrrole-2-carboxylic acid;ethane?
The canonical SMILES for 4-butyl-5-[4-hydroxy-2-(trifluoromethyl)phenyl]thieno[3,2-b]pyrrole-2-carboxylic acid;ethane is CC.CCCCn1c(-c2ccc(O)cc2C(F)(F)F)cc2sc(C(=O)O)cc21.
What is the InChIKey of 4-butyl-5-[4-hydroxy-2-(trifluoromethyl)phenyl]thieno[3,2-b]pyrrole-2-carboxylic acid;ethane?
The InChIKey is MJGXKPPPSABOCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F3NO3S.C2H6/c1-2-3-6-22-13(8-15-14(22)9-16(26-15)17(24)25)11-5-4-10(23)7-12(11)18(19,20)21;1-2/h4-5,7-9,23H,2-3,6H2,1H3,(H,24,25);1-2H3.
What are the key properties of 4-butyl-5-[4-hydroxy-2-(trifluoromethyl)phenyl]thieno[3,2-b]pyrrole-2-carboxylic acid;ethane?
4-butyl-5-[4-hydroxy-2-(trifluoromethyl)phenyl]thieno[3,2-b]pyrrole-2-carboxylic acid;ethane has a molecular weight of 413.46 g/mol, XLogP of 6.62, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-5-[4-hydroxy-2-(trifluoromethyl)phenyl]thieno[3,2-b]pyrrole-2-carboxylic acid;ethane is sourced from PubChem (CID 145137115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).