C23H26F3NO3S — CID 145137194
4-(6-cyclohexyl-2,4-dimethylthieno[3,2-b]pyrrol-5-yl)-3-(trifluoromethyl)phenol;(Z)-ethene-1,2-diol (PubChem CID 145137194) has the molecular formula C23H26F3NO3S and a molecular weight of 453.53 g/mol. Its IUPAC name is 4-(6-cyclohexyl-2,4-dimethylthieno[3,2-b]pyrrol-5-yl)-3-(trifluoromethyl)phenol;(Z)-ethene-1,2-diol.
| Compound Name | 4-(6-cyclohexyl-2,4-dimethylthieno[3,2-b]pyrrol-5-yl)-3-(trifluoromethyl)phenol;(Z)-ethene-1,2-diol |
|---|---|
| PubChem CID | 145137194 |
| Molecular Formula | C23H26F3NO3S |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 4-(6-cyclohexyl-2,4-dimethylthieno[3,2-b]pyrrol-5-yl)-3-(trifluoromethyl)phenol;(Z)-ethene-1,2-diol |
| SMILES | Cc1cc2c(s1)c(C1CCCCC1)c(-c1ccc(O)cc1C(F)(F)F)n2C.O/C=C\O |
| InChI | InChI=1S/C21H22F3NOS.C2H4O2/c1-12-10-17-20(27-12)18(13-6-4-3-5-7-13)19(25(17)2)15-9-8-14(26)11-16(15)21(22,23)24;3-1-2-4/h8-11,13,26H,3-7H2,1-2H3;1-4H/b;2-1- |
| InChIKey | FZNJOGQHEDNIMD-BTJKTKAUSA-N |
| XLogP | 7.56 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|