C24H18N4O3S — CID 145137268
4-[2-formyl-5-(4-imidazol-1-yl-2-methylphenyl)thieno[3,2-b]pyrrol-4-yl]-2-hydroxybenzamide (PubChem CID 145137268) has the molecular formula C24H18N4O3S and a molecular weight of 442.50 g/mol. Its IUPAC name is 4-[2-formyl-5-(4-imidazol-1-yl-2-methylphenyl)thieno[3,2-b]pyrrol-4-yl]-2-hydroxybenzamide.
| Compound Name | 4-[2-formyl-5-(4-imidazol-1-yl-2-methylphenyl)thieno[3,2-b]pyrrol-4-yl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 145137268 |
| Molecular Formula | C24H18N4O3S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 4-[2-formyl-5-(4-imidazol-1-yl-2-methylphenyl)thieno[3,2-b]pyrrol-4-yl]-2-hydroxybenzamide |
| SMILES | Cc1cc(-n2ccnc2)ccc1-c1cc2sc(C=O)cc2n1-c1ccc(C(N)=O)c(O)c1 |
| InChI | InChI=1S/C24H18N4O3S/c1-14-8-15(27-7-6-26-13-27)2-4-18(14)20-11-23-21(10-17(12-29)32-23)28(20)16-3-5-19(24(25)31)22(30)9-16/h2-13,30H,1H3,(H2,25,31) |
| InChIKey | URXNIDPBSGJJPV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|