C20H17Cl2N3O3 — CID 145137348
4-[2-[(2,4-dichloropyridine-3-carbonyl)amino]cyclohexene-1-carboximidoyl]benzoic acid (PubChem CID 145137348) has the molecular formula C20H17Cl2N3O3 and a molecular weight of 418.28 g/mol. Its IUPAC name is 4-[2-[(2,4-dichloropyridine-3-carbonyl)amino]cyclohexene-1-carboximidoyl]benzoic acid.
| Compound Name | 4-[2-[(2,4-dichloropyridine-3-carbonyl)amino]cyclohexene-1-carboximidoyl]benzoic acid |
|---|---|
| PubChem CID | 145137348 |
| Molecular Formula | C20H17Cl2N3O3 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 4-[2-[(2,4-dichloropyridine-3-carbonyl)amino]cyclohexene-1-carboximidoyl]benzoic acid |
| SMILES | [H]/N=C(/C1=C(NC(=O)c2c(Cl)ccnc2Cl)CCCC1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C20H17Cl2N3O3/c21-14-9-10-24-18(22)16(14)19(26)25-15-4-2-1-3-13(15)17(23)11-5-7-12(8-6-11)20(27)28/h5-10,23H,1-4H2,(H,25,26)(H,27,28)/b23-17+ |
| InChIKey | ZRZQLYGHMJAUFL-HAVVHWLPSA-N |
| XLogP | 4.71 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|